| Name | methyl trans-3-hexenoate |
| Synonyms | FEMA 3364 Einecs 219-256-1 methyl hex-3-enoate METHYL TRANS-3-HEXENOATE methyl trans-3-hexenoate Methyl-trans-3-hexenoate 3-Hexenoicacid,methylester Hydrosorbic acid, methyl ester Methyl 3-hexenoate, predominantly trans |
| CAS | 2396-78-3 |
| EINECS | 219-256-1 |
| InChI | InChI=1/C7H12O2/c1-3-4-5-6-7(8)9-2/h4-5H,3,6H2,1-2H3 |
| Molecular Formula | C7H12O2 |
| Molar Mass | 128.17 |
| Density | 0.913 g/mL at 25 °C (lit.) |
| Melting Point | -62.68°C (estimate) |
| Boling Point | 169 °C (lit.) |
| Flash Point | 115 ºF |
| JECFA Number | 334 |
| Vapor Presure | 4.78mmHg at 25°C |
| Appearance | Liquid |
| Color | Clear colorless to faintly yellow |
| Storage Condition | Flammables area |
| Refractive Index | 1.4260 |
| Risk Codes | 10 - Flammable |
| Safety Description | 16 - Keep away from sources of ignition. |
| UN IDs | UN 3272 |
| WGK Germany | 3 |
| HS Code | 29161900 |
| FEMA | 3364 | METHYL 3-HEXENOATE |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| toxicity | GRAS(FEMA). |
| usage limit | FEMA(mg/kg): soft drinks, cold drinks, gel products, pudding, smeared food, all 2.0; Candy, baked goods, 4.0. |